Loading distributor info...
| Description | Acemetacin is a glycolic acid ester of indometacin. It is metabolized to indometacin, which then acts as an inhibitor of cyclooxygenase, producing the anti-inflammatory effects. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11692 |
|---|---|
| Formula | C21H18ClNO6 |
| Molecular Weight | 415.82 |
| CAS Number | 53164-05-9 |
| SMILES | CC1=C(C2=C(N1C(=O)C3=CC=C(C=C3)Cl)C=CC(=C2)OC)CC(=O)OCC(=O)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 82 mg/mL (197.2 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 57 mg/mL (137.08 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.05 mL | 120.24 mL | 240.49 mL |
| 0.5 mM | 4.81 mL | 24.05 mL | 48.1 mL |
| 1 mM | 2.4 mL | 12.02 mL | 24.05 mL |
| 5 mM | 0.48 mL | 2.4 mL | 4.81 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
