Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Acetylcholine iodide is a neurotransmitter found at neuromuscular junctions, autonomic ganglia, parasympathetic effector junctions, a subset of sympathetic effector junctions, and at many sites in the central nervous system. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16390 |
|---|---|
| Formula | C7H16NO2.I |
| Molecular Weight | 273.11 |
| CAS Number | 2260-50-6 |
| SMILES | CC(=O)OCC[N+](C)(C)C.[I-] |
| Synonyms | Acetylcolina |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 49 mg/mL (179.41 mM) | |
| Water | 49 mg/mL (179.41 mM) | ||
| Ethanol | 49 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 36.62 mL | 183.08 mL | 366.15 mL |
| 0.5 mM | 7.32 mL | 36.62 mL | 73.23 mL |
| 1 mM | 3.66 mL | 18.31 mL | 36.62 mL |
| 5 mM | 0.73 mL | 3.66 mL | 7.32 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
