Loading distributor info...
| Description | ACY-775 is a potent and selective inhibitor of the of histone deacetylase 6 (HDAC6) with an IC50 of 7.5?nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12456 |
|---|---|
| Formula | C17H19FN4O2 |
| Molecular Weight | 330.36 |
| CAS Number | 1375466-18-4 |
| SMILES | O=C(NO)C(C=N1)=CN=C1NC2(CCCCC2)C3=CC=CC(F)=C3 |
| Synonyms | ACY775, ACY 775 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 63 mg/mL (190.7 mM) | |
| Water | Insoluble | ||
| Ethanol | 63 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 30.27 mL | 151.35 mL | 302.7 mL |
| 0.5 mM | 6.05 mL | 30.27 mL | 60.54 mL |
| 1 mM | 3.03 mL | 15.14 mL | 30.27 mL |
| 5 mM | 0.61 mL | 3.03 mL | 6.05 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
