Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Adenosine diphosphate is an adenine nucleotide containing two phosphate groups esterified to the sugar moiety at the 5'-position. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17875 |
|---|---|
| Formula | C10H15N5O10P2 |
| Molecular Weight | 427.2 |
| CAS Number | 58-64-0 |
| SMILES | O[C@@H]([C@H]([C@H](N1C=NC2=C(N=CN=C21)N)O3)O)[C@H]3COP(O)(OP(O)(O)=O)=O |
| Synonyms | Adenosine diphosphate; Ado-5'-P-P |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 5 mg/mL (11.7 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.41 mL | 117.04 mL | 234.08 mL |
| 0.5 mM | 4.68 mL | 23.41 mL | 46.82 mL |
| 1 mM | 2.34 mL | 11.7 mL | 23.41 mL |
| 5 mM | 0.47 mL | 2.34 mL | 4.68 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
