Loading distributor info...
| Description | Ambroxol is a secretolytic agent used in the treatment of respiratory diseases associated with viscid or excessive mucus. |
|---|
| Catalog Num | A17742 |
|---|---|
| Formula | C13H18Br2N2O |
| Molecular Weight | 378.11 |
| CAS Number | 18683-91-5 |
| SMILES | O[C@H]1CC[C@H](NCC2=CC(Br)=CC(Br)=C2N)CC1 |
| Synonyms | Ambroxol |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 74 mg/mL (195.71 mM) | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.45 mL | 132.24 mL | 264.47 mL |
| 0.5 mM | 5.29 mL | 26.45 mL | 52.89 mL |
| 1 mM | 2.64 mL | 13.22 mL | 26.45 mL |
| 5 mM | 0.53 mL | 2.64 mL | 5.29 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
