Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | AMG-333 is a potent and selective TRPM8 Antagonist. |
|---|
| Catalog Num | A17182 |
|---|---|
| Formula | C20H12F5N3O4 |
| Molecular Weight | 453.32 |
| CAS Number | 1416799-28-4 |
| SMILES | O=C(O)C1=CN=C(C(N[C@@H](C2=CC=C(OC(F)(F)F)C(F)=C2)C3=NC=CC=C3F)=O)C=C1 |
| Synonyms | AMG333, AMG 333 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 81 mg/mL (178.68 mM) | |
| Water | Insoluble | ||
| Ethanol | 81 mg/mL (178.68 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.06 mL | 110.3 mL | 220.59 mL |
| 0.5 mM | 4.41 mL | 22.06 mL | 44.12 mL |
| 1 mM | 2.21 mL | 11.03 mL | 22.06 mL |
| 5 mM | 0.44 mL | 2.21 mL | 4.41 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
