Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | AMG9810 is a selective and competitive vanilloid receptor 1 (TRPV1) antagonist with IC50 values of 24.5 and 85.6 nM for human and rat TRPV1, repectively. |
|---|
| Catalog Num | A19555 |
|---|---|
| Formula | C21H23NO3 |
| Molecular Weight | 337.41 |
| CAS Number | 545395-94-6 |
| SMILES | O=C(NC1=CC=C(OCCO2)C2=C1)/C=C/C3=CC=C(C(C)(C)C)C=C3 |
| Synonyms | AMG-9810; AMG 9810 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 64 mg/mL (189.68 mM) | |
| Water | Insoluble | ||
| Ethanol | 24 mg/mL (71.13 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.64 mL | 148.19 mL | 296.38 mL |
| 0.5 mM | 5.93 mL | 29.64 mL | 59.28 mL |
| 1 mM | 2.96 mL | 14.82 mL | 29.64 mL |
| 5 mM | 0.59 mL | 2.96 mL | 5.93 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
