Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | AMZ30 is a selective, covalent inhibitors of protein phosphatase methylesterase-1(PME-1) with IC50 value of 600 nM. |
|---|
| Catalog Num | A17131 |
|---|---|
| Formula | C19H12FN3O6S2 |
| Molecular Weight | 461.44 |
| CAS Number | 1313613-09-0 |
| SMILES | O=S(C1=CC([N+]([O-])=O)=CC=C1)(N2C(/C=C(S(=O)(C3=CC=C(F)C=C3)=O)\C#N)=CC=C2)=O |
| Synonyms | AMZ-30, AMZ 30 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 79 mg/mL (171.2 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.67 mL | 108.36 mL | 216.71 mL |
| 0.5 mM | 4.33 mL | 21.67 mL | 43.34 mL |
| 1 mM | 2.17 mL | 10.84 mL | 21.67 mL |
| 5 mM | 0.43 mL | 2.17 mL | 4.33 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
