Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Angelicin is a furanocoumarin typically isolated from the seeds of P. corylifolia. It has also been shown to prevent tacrine-induced cytotoxicity in human liver-derived HepG2 cells (EC50 = 47 ug/ml) and vascular relaxation in phenylephrine-precontracted rat aorta. |
|---|
| Catalog Num | A12198 |
|---|---|
| Formula | C11H6O3 |
| Molecular Weight | 186.2 |
| CAS Number | 523-50-2 |
| SMILES | C1=CC2=C(C=CO2)C3=C1C=CC(=O)O3 |
| Synonyms | NSC 404563, Bakuchicin |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 13 mg/mL (69.83 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 53.71 mL | 268.53 mL | 537.06 mL |
| 0.5 mM | 10.74 mL | 53.71 mL | 107.41 mL |
| 1 mM | 5.37 mL | 26.85 mL | 53.71 mL |
| 5 mM | 1.07 mL | 5.37 mL | 10.74 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
