Loading distributor info...
| Description | APL180 is an apolipoprotein A-I mimic peptide that enhances the anti-inflammatory activity of high-density lipoprotein (HDL). This compound is valuable in research focused on cardiovascular diseases, leveraging its properties to study HDL's role in inflammation and lipid metabolism. |
|---|
| Catalog Num | A69544 |
|---|---|
| Formula | C114H156N24O28 |
| Molecular Weight | 2310.60 |
| CAS Number | 388566-97-0 |
| Sequence | Ac-Asp-Trp-Phe-Lys-Ala-Phe-Tyr-Asp-Lys-Val-Ala-Glu-Lys-Phe-Lys-Glu-Ala-Phe-NH2 |
| Sequence shortening | Ac-DWFKAFYDKVAEKFKEAF-NH2 |
| SMILES | C([C@@H](C(N[C@@H](CC1=CC=CC=C1)C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@@H](CC2=CC=C(O)C=C2)C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@@H](CC3=CC=CC=C3)C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@@H](CC4=CC=CC=C4)C(N)=O)=O)C)=O)CCC(O)=O)=O)CCCCN)=O)=O)CCCCN)=O)CCC(O)=O)=O)C)=O)C(C)C)=O)CCCCN)=O)CC(O)=O)=O)=O)CC5=CC=CC=C5)=O)C)=O)CCCCN)=O)=O)NC([C@H](CC(O)=O)NC(C)=O)=O)C=6C=7C(NC6)=CC=CC7 |
| Synonyms | L-4F |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
