Loading distributor info...
| Description | Apoptozole (Apoptosis Activator VII) is an inhibitor of the ATPase domain of Hsc70 and Hsp70, with Kds of 0.21 and 0.14?μM, respectively, and can induce apoptosis. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A21177 |
|---|---|
| Formula | C33H25F6N3O3 |
| Molecular Weight | 625.56 |
| CAS Number | 1054543-47-3 |
| SMILES | NC(C(C=C1)=CC=C1CN2C(C3=CC=C(OC)C=C3)=C(C4=CC=C(OC)C=C4)N=C2C5=CC(C(F)(F)F)=CC(C(F)(F)F)=C5)=O |
| Synonyms | Apoptosis Activator VII |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 96 mg/mL (153.46 mM) | |
| Water | Insoluble | ||
| Ethanol | 24 mg/mL (38.36 mM) | ||
| In vivo | 2% DMSO+30% PEG 300+5% Tween 80+ddH2O | 4 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 15.99 mL | 79.93 mL | 159.86 mL |
| 0.5 mM | 3.2 mL | 15.99 mL | 31.97 mL |
| 1 mM | 1.6 mL | 7.99 mL | 15.99 mL |
| 5 mM | 0.32 mL | 1.6 mL | 3.2 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
