Loading distributor info...
| Description | AZ6102 is a potent TNKS1/2 inhibitor that has 100-fold selectivity against other PARP family enzymes and shows IC50 of 5 nM for Wnt pathway inhibition in DLD-1 cells. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15873 |
|---|---|
| Formula | C25H28N6O |
| Molecular Weight | 428.53 |
| CAS Number | 1645286-75-4 |
| SMILES | C[C@H]1CN(C2=NC=C(C3=CC=C(C4=NC(C(C=CN5C)=C5N4)=O)C=C3)C(C)=C2)C[C@@H](C)N1 |
| Synonyms | AZ-6102, AZ 6102 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 83 mg/mL (193.68 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.34 mL | 116.68 mL | 233.36 mL |
| 0.5 mM | 4.67 mL | 23.34 mL | 46.67 mL |
| 1 mM | 2.33 mL | 11.67 mL | 23.34 mL |
| 5 mM | 0.47 mL | 2.33 mL | 4.67 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
