Loading distributor info...
| Description | AZD7986, also known as INS 1007, is a second generation reversible covalent, potent and selective DPP1 inhibitor potentially for the treatment of chronic obstructive pulmonary disease (COPD) with predicted human PK properties suitable for once daily human dosing. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A17095 |
|---|---|
| Formula | C23H24N4O4 |
| Molecular Weight | 420.47 |
| CAS Number | 1802148-05-5 |
| SMILES | N#C[C@H](CC1=CC=C(C2=CC=C(OC(N3C)=O)C3=C2)C=C1)NC([C@H]4OCCCNC4)=O |
| Synonyms | AZD 7986, AZD-7986, INS 1007, INS-1007, INS1007 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
