Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | BAR501 is a potent and selective agonist of GPBAR1 with an EC50 of 1 μM. |
|---|
| Catalog Num | A20429 |
|---|---|
| Formula | C26H46O3 |
| Molecular Weight | 406.64 |
| CAS Number | 1632118-69-4 |
| SMILES | C[C@H](CCCO)[C@@]1([H])CC[C@@]2([H])[C@]3([H])[C@@H](O)[C@@H](CC)[C@]4([H])C[C@H](O)CC[C@]4(C)[C@@]3([H])CC[C@@]21C |
| Synonyms | BAR 501, BAR-501 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 79 mg/mL (194.27 mM) | |
| Water | Insoluble | ||
| Ethanol | 79 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.59 mL | 122.96 mL | 245.92 mL |
| 0.5 mM | 4.92 mL | 24.59 mL | 49.18 mL |
| 1 mM | 2.46 mL | 12.3 mL | 24.59 mL |
| 5 mM | 0.49 mL | 2.46 mL | 4.92 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
