Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | BCTC is a potent and specific inhibitor of transient receptor potential cation channel subfamily M member 8 (TRPM8) in prostate cancer (PCa) DU145 cells. |
|---|
| Catalog Num | A20623 |
|---|---|
| Formula | C20H25ClN4O |
| Molecular Weight | 372.89 |
| CAS Number | 393514-24-4 |
| SMILES | O=C(N1CCN(C2=NC=CC=C2Cl)CC1)NC3=CC=C(C(C)(C)C)C=C3 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 72 mg/mL (193.08 mM) | |
| Water | <1 mg/mL | ||
| Ethanol | 25 mg/mL (67.04 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.82 mL | 134.09 mL | 268.18 mL |
| 0.5 mM | 5.36 mL | 26.82 mL | 53.64 mL |
| 1 mM | 2.68 mL | 13.41 mL | 26.82 mL |
| 5 mM | 0.54 mL | 2.68 mL | 5.36 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
