Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Besifovir (LB80331), a parent drug converted by LB80380, further metabolizes to its active form, LB80317. LB80380 is potent antiviral agent against hepatitis B virus (HBV) . |
|---|
| Catalog Num | A20775 |
|---|---|
| Formula | C10H14N5O4P |
| Molecular Weight | 299.22 |
| CAS Number | 441785-25-7 |
| SMILES | NC1=NC=C2N=CN(CC3(OCP(O)(O)=O)CC3)C2=N1 |
| Synonyms | LB80331, LB 80331, LB-80331 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 56 mg/mL (187.15 mM) | |
| Water | 56 mg/mL (187.15 mM) | ||
| Ethanol | 2 mg/mL (6.68 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 33.42 mL | 167.1 mL | 334.2 mL |
| 0.5 mM | 6.68 mL | 33.42 mL | 66.84 mL |
| 1 mM | 3.34 mL | 16.71 mL | 33.42 mL |
| 5 mM | 0.67 mL | 3.34 mL | 6.68 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
