Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | BMS-1166 is a potent PD-1/PD-L1 interaction inhibitor with an IC50 of 1.4 nM. BMS-1166 antagonizes the inhibitory effect of PD-1/PD-L1 immune checkpoint on T cell activation. |
|---|
| Catalog Num | A13129 |
|---|---|
| Formula | C36H33ClN2O7 |
| Molecular Weight | 641.11 |
| CAS Number | 1818314-88-3 |
| SMILES | O=C(O)[C@@H]1N(CC2=CC(Cl)=C(OCC3=CC=CC(C4=CC=C(OCCO5)C5=C4)=C3C)C=C2OCC6=CC=CC(C#N)=C6)C[C@H](O)C1 |
| Synonyms | BMS 1166, BMS1166 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 91 mg/mL (141.93 mM) | |
| Water | Insoluble | ||
| Ethanol | 12 mg/mL (18.71 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 15.6 mL | 77.99 mL | 155.98 mL |
| 0.5 mM | 3.12 mL | 15.6 mL | 31.2 mL |
| 1 mM | 1.56 mL | 7.8 mL | 15.6 mL |
| 5 mM | 0.31 mL | 1.56 mL | 3.12 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
