Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Brivudine is a thymidine analogue with antiviral activity, indicated for the early treatment of acute herpes zoster. |
|---|
| Catalog Num | A17482 |
|---|---|
| Formula | C11H13BrN2O5 |
| Molecular Weight | 333.14 |
| CAS Number | 69304-47-8 |
| SMILES | OC[C@@H]1[C@H](C[C@H](N2C(NC(C(/C=C/Br)=C2)=O)=O)O1)O |
| Synonyms | Bromovinyldeoxyuridine; BVDU |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 60 mg/mL (180.1 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 30.02 mL | 150.09 mL | 300.17 mL |
| 0.5 mM | 6 mL | 30.02 mL | 60.03 mL |
| 1 mM | 3 mL | 15.01 mL | 30.02 mL |
| 5 mM | 0.6 mL | 3 mL | 6 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
