Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Butoconazole is a imidazole, effective as therapy for vulvovaginal candidiasis for women who prefer solid-type vaginal preparations. |
|---|
| Catalog Num | A17605 |
|---|---|
| Formula | C19H17Cl3N2S |
| Molecular Weight | 411.76 |
| CAS Number | 64872-76-0 |
| SMILES | ClC1=C(SC(CCC2=CC=C(Cl)C=C2)CN3C=CN=C3)C(Cl)=CC=C1 |
| Synonyms | Butoconazole; RS 35887-10-3; RS-35887-10-3; RS35887-10-3; |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 81 mg/mL (196.7 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.29 mL | 121.43 mL | 242.86 mL |
| 0.5 mM | 4.86 mL | 24.29 mL | 48.57 mL |
| 1 mM | 2.43 mL | 12.14 mL | 24.29 mL |
| 5 mM | 0.49 mL | 2.43 mL | 4.86 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
