Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | BX-795 is a potent PDK1 inhibitor that blocks PDK1/Akt signaling in tumor cells and inhibits the anchorage-dependent growth of a variety of tumor cell lines in culture or induced apoptosis. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11148 |
|---|---|
| Formula | C23H26IN7O2S |
| Molecular Weight | 591.5 |
| CAS Number | 702675-74-9 |
| SMILES | C1CCN(C1)C(=O)NC2=CC=CC(=C2)NC3=NC=C(C(=N3)NCCCNC(=O)C4=CC=CS4)I |
| Synonyms | BX795 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 88 mg/mL (148.78 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 2% DMSO+30% PEG +2% Tween 80+ddH2O | 3 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 16.91 mL | 84.53 mL | 169.06 mL |
| 0.5 mM | 3.38 mL | 16.91 mL | 33.81 mL |
| 1 mM | 1.69 mL | 8.45 mL | 16.91 mL |
| 5 mM | 0.34 mL | 1.69 mL | 3.38 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
