Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | C-176 is a strong and covalent mouse STING inhibitor. |
|---|
| Catalog Num | A20121 |
|---|---|
| Formula | C11H7IN2O4 |
| Molecular Weight | 358.09 |
| CAS Number | 314054-00-7 |
| SMILES | O=C(C1=CC=C([N+]([O-])=O)O1)NC2=CC=C(I)C=C2 |
| Synonyms | C176, C 176 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 61 mg/mL (170.34 mM) | |
| Water | Insoluble | ||
| Ethanol | 2 mg/mL (5.58 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.93 mL | 139.63 mL | 279.26 mL |
| 0.5 mM | 5.59 mL | 27.93 mL | 55.85 mL |
| 1 mM | 2.79 mL | 13.96 mL | 27.93 mL |
| 5 mM | 0.56 mL | 2.79 mL | 5.59 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
