Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Cariporide (HOE-642) is a selective Na+/H+ exchange inhibitor. |
|---|
| Catalog Num | A12872 |
|---|---|
| Formula | C12H17N3O3S |
| Molecular Weight | 283.35 |
| CAS Number | 159138-80-4 |
| SMILES | O=C(NC(N)=N)C1=CC=C(C(C)C)C(S(=O)(C)=O)=C1 |
| Synonyms | HOE-642, HOE 642, HOE 642 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 84 mg/mL (296.45 mM) | |
| Water | Insoluble | ||
| Ethanol | 3 mg/mL (10.58 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 35.29 mL | 176.46 mL | 352.92 mL |
| 0.5 mM | 7.06 mL | 35.29 mL | 70.58 mL |
| 1 mM | 3.53 mL | 17.65 mL | 35.29 mL |
| 5 mM | 0.71 mL | 3.53 mL | 7.06 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
