Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Cathepsin Inhibitor 1 is an inhibitor of Cathepsin (L, L2, S, K, B) with pIC50 of 7.9, 6.7, 6.0, 5.5 and 5.2, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11466 |
|---|---|
| Formula | C20H24ClN5O2 |
| Molecular Weight | 401.89 |
| CAS Number | 225120-65-0 |
| SMILES | CC(C)(C)C1=NN(C(=C1)C(=O)NC(CC2=CC(=CC=C2)Cl)C(=O)NCC#N)C |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 70 mg/mL (174.17 mM) | |
| Water | Insoluble | ||
| Ethanol | 44 mg/mL (109.48 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.88 mL | 124.41 mL | 248.82 mL |
| 0.5 mM | 4.98 mL | 24.88 mL | 49.76 mL |
| 1 mM | 2.49 mL | 12.44 mL | 24.88 mL |
| 5 mM | 0.5 mL | 2.49 mL | 4.98 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
