Loading distributor info...
| Description | CBR 5884 is an inhibitor of 3-phosphoglycerate dehydrogenase (PHGDH), inhibiting serine synthesis from 3-phosphoglycerate in cells with an IC50 value of 33 uM. |
|---|
| Catalog Num | A16176 |
|---|---|
| Formula | C14H12N2O4S2 |
| Molecular Weight | 336.38 |
| CAS Number | 681159-27-3 |
| SMILES | CCOC(=O)C1=C(C(=C(S1)NC(=O)C2=CC=CO2)SC#N)C |
| Synonyms | CBR-5884, CBR5884 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 58 mg/mL (172.42 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.73 mL | 148.64 mL | 297.28 mL |
| 0.5 mM | 5.95 mL | 29.73 mL | 59.46 mL |
| 1 mM | 2.97 mL | 14.86 mL | 29.73 mL |
| 5 mM | 0.59 mL | 2.97 mL | 5.95 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
