Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Cefsulodin sodium salt hydrate is a third generation β lactam antibiotic and member of the cephems subgroub of antibiotics. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17280 |
|---|---|
| Formula | C22H19N4NaO8S2 |
| Molecular Weight | 554.53 |
| CAS Number | 52152-93-9 |
| SMILES | O=C(C(N12)=C(C[N+]3=CC=C(C(N)=O)C=C3)CS[C@]2([H])[C@H](NC([C@@H](C4=CC=CC=C4)S(=O)([O-])=O)=O)C1=O)[O-].[Na+] |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 98 mg/mL (176.72 mM) | |
| Water | 98 mg/mL (176.72 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.03 mL | 90.17 mL | 180.33 mL |
| 0.5 mM | 3.61 mL | 18.03 mL | 36.07 mL |
| 1 mM | 1.8 mL | 9.02 mL | 18.03 mL |
| 5 mM | 0.36 mL | 1.8 mL | 3.61 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
