Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Cephapirin Benzathine is the benzathine salt form of cephapirin. Cephapirin Benzathine is the first generation cephalosporin with broad spectrum antibiotic activity. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17456 |
|---|---|
| Formula | C50H54N8O12S4 |
| Molecular Weight | 1087.27 |
| CAS Number | 97468-37-6 |
| SMILES | O=C(C(N12)=C(COC(C)=O)CS[C@]2([H])[C@H](NC(CSC3=CC=NC=C3)=O)C1=O)O.O=C(C(N45)=C(COC(C)=O)CS[C@]5([H])[C@H](NC(CSC6=CC=NC=C6)=O)C4=O)O.C7(CNCCNCC8=CC=CC=C8)=CC=CC=C7 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 77 mg/mL (70.81 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 9.2 mL | 45.99 mL | 91.97 mL |
| 0.5 mM | 1.84 mL | 9.2 mL | 18.39 mL |
| 1 mM | 0.92 mL | 4.6 mL | 9.2 mL |
| 5 mM | 0.18 mL | 0.92 mL | 1.84 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
