Loading distributor info...
| Description | CHF5074 is a novel γ-secretase modulator, reduces Aβ42 and Aβ40 secretion, with an IC50 of 3.6 and 18.4 uM, respectively. |
|---|
| Catalog Num | A16214 |
|---|---|
| Formula | C16H11Cl2FO2 |
| Molecular Weight | 325.16 |
| CAS Number | 749269-83-8 |
| SMILES | O=C(C1(C2=CC=C(C3=CC=C(Cl)C(Cl)=C3)C(F)=C2)CC1)O |
| Synonyms | CSP-1103, CHF-5074 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 51 mg/mL (156.84 mM) | |
| Water | Insoluble | ||
| Ethanol | 8 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 30.75 mL | 153.77 mL | 307.54 mL |
| 0.5 mM | 6.15 mL | 30.75 mL | 61.51 mL |
| 1 mM | 3.08 mL | 15.38 mL | 30.75 mL |
| 5 mM | 0.62 mL | 3.08 mL | 6.15 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
