Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Chlorhexidine hydrochloride is an antiseptic effective against a wide variety of gram-negative and gram-positive organisms. |
|---|
| Catalog Num | A16442 |
|---|---|
| Formula | C22H30Cl2N10.2HCl |
| Molecular Weight | 578.37 |
| CAS Number | 3697-42-5 |
| SMILES | C1=CC(=CC=C1NC(=NC(=NCCCCCCN=C(N)N=C(N)NC2=CC=C(C=C2)Cl)N)N)Cl.Cl.Cl |
| Synonyms | NSC-185 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 86 mg/mL (148.69 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 2% DMSO+30% PEG 300+2% Tween 80+ddH2O | 2 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.29 mL | 86.45 mL | 172.9 mL |
| 0.5 mM | 3.46 mL | 17.29 mL | 34.58 mL |
| 1 mM | 1.73 mL | 8.64 mL | 17.29 mL |
| 5 mM | 0.35 mL | 1.73 mL | 3.46 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
