Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Clindamycin Phosphate is a lincosamide antibiotic for Plasmodium falciparum with IC50 of 12 nM. |
|---|
| Catalog Num | A16460 |
|---|---|
| Formula | C18H34ClN2O8PS |
| Molecular Weight | 504.96 |
| CAS Number | 24729-96-2 |
| SMILES | CCCC1CC(N(C1)C)C(=O)NC(C2C(C(C(C(O2)SC)OP(=O)(O)O)O)O)C(C)Cl |
| Synonyms | Clindamycin 2-dihydrogen phosphate, Clindamycin 2-phosphate, U-28508 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Insoluble | |
| Water | 95 mg/mL (188.13 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.8 mL | 99.02 mL | 198.04 mL |
| 0.5 mM | 3.96 mL | 19.8 mL | 39.61 mL |
| 1 mM | 1.98 mL | 9.9 mL | 19.8 mL |
| 5 mM | 0.4 mL | 1.98 mL | 3.96 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
