Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | Colistin is a cyclic cationic decapeptide linked to a fatty acid side chain, it belongs to a group of similarly structured bacterial antimicrobial peptides. |
|---|
| Catalog Num | A16469 |
|---|---|
| Formula | H2O4S.xUnspecified |
| Molecular Weight | 1267.55 |
| CAS Number | 1264-72-8 |
| SMILES | O=C(N[C@@H](CCN)C(N[C@H](CC(C)C)C(N[C@@H](CC(C)C)C(N[C@@H](CCN)C(N[C@H]1CCN)=O)=O)=O)=O)[C@@H](NC([C@H](CCN)NC([C@@H](NC([C@H](CCN)NC(CCCC[C@H](C)CC)=O)=O)[C@@H](C)O)=O)=O)CCNC([C@H]([C@@H](C)O)NC1=O)=O.OS(O)(=O)=O |
| Synonyms | Polymyxin E Sulfate |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Insoluble | |
| Water | 88 mg/mL | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 7.89 mL | 39.45 mL | 78.89 mL |
| 0.5 mM | 1.58 mL | 7.89 mL | 15.78 mL |
| 1 mM | 0.79 mL | 3.94 mL | 7.89 mL |
| 5 mM | 0.16 mL | 0.79 mL | 1.58 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
