Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | DC661 is a potent palmitoyl-protein thioesterase 1 (PPT1) inhibitor. DC661 inhibits autophagy. DC661 is capable of deacidifying the lysosome and inhibiting autophagy significantly better than hydroxychloroquine (HCQ). |
|---|
| Catalog Num | A17236 |
|---|---|
| Formula | C31H39Cl2N5 |
| Molecular Weight | 552.588 |
| CAS Number | 1872387-43-3 |
| SMILES | CN(CCCCCCNC1=CC=NC2=CC(Cl)=CC=C12)CCCCCCNC3=CC=NC4=CC(Cl)=CC=C34 |
| Synonyms | DC-661; DC 661; |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 55 mg/mL (99.53 mM) | |
| Water | Insoluble | ||
| Ethanol | 44 mg/mL (79.62 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.1 mL | 90.48 mL | 180.97 mL |
| 0.5 mM | 3.62 mL | 18.1 mL | 36.19 mL |
| 1 mM | 1.81 mL | 9.05 mL | 18.1 mL |
| 5 mM | 0.36 mL | 1.81 mL | 3.62 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
