Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Dehydrocostus Lactone inhibits NF kappa B activation by preventing TNF-α induced degradation and phosphorylation. |
|---|
| Catalog Num | A14809 |
|---|---|
| Formula | C15H18O2 |
| Molecular Weight | 230.3 |
| CAS Number | 477-43-0 |
| SMILES | C=C1CCC2C(C3C1CCC3=C)OC(=O)C2=C |
| Synonyms | Dehydrocostuslactone |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 42 mg/mL (182.36 mM) | |
| Water | Insoluble | ||
| Ethanol | 42 mg/mL (182.36 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 43.42 mL | 217.11 mL | 434.22 mL |
| 0.5 mM | 8.68 mL | 43.42 mL | 86.84 mL |
| 1 mM | 4.34 mL | 21.71 mL | 43.42 mL |
| 5 mM | 0.87 mL | 4.34 mL | 8.68 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
