Denifanstat (TVB-2640) is a Fatty Acid Synthase (FASN) inhibitor extracted from patent WO2012122391A1, compound 152, has an IC50 of 0.052 μM and an EC50 of 0.072 μM.
Loading distributor info...
| Description | Denifanstat (TVB-2640) is a Fatty Acid Synthase (FASN) inhibitor extracted from patent WO2012122391A1, compound 152, has an IC50 of 0.052 μM and an EC50 of 0.072 μM. |
|---|
| Catalog Num | A13063 |
|---|---|
| Formula | C27H29N5O |
| Molecular Weight | 439.55 |
| CAS Number | 1399177-37-7 |
| SMILES | N#CC1=CC=C(C2CCN(C(C3=CC(C4=NC(C)=NN4)=C(C5CCC5)C=C3C)=O)CC2)C=C1 |
| Synonyms | FASN-IN-2 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 79 mg/mL (179.73 mM) | |
| Water | Insoluble | ||
| Ethanol | 79 mg/mL (179.73 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.75 mL | 113.75 mL | 227.51 mL |
| 0.5 mM | 4.55 mL | 22.75 mL | 45.5 mL |
| 1 mM | 2.28 mL | 11.38 mL | 22.75 mL |
| 5 mM | 0.46 mL | 2.28 mL | 4.55 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
