Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Deracoxib is an NSAID and COX-2 inhibitor used to treat osteoarthritis. It induces cell cycle arrest and apoptosis in mammary tumor cells, decreases platelet aggregation, and lowers inflammatory responses. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A18077 |
|---|---|
| Formula | C17H14F3N3O3S |
| Molecular Weight | 397.37 |
| CAS Number | 169590-41-4 |
| SMILES | O=S(C1=CC=C(N2N=C(C(F)F)C=C2C3=CC=C(OC)C(F)=C3)C=C1)(N)=O |
| Synonyms | Deracoxib; SC 046; SC046; SC-046; |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 74 mg/mL (186.22 mM) | |
| Water | Insoluble | ||
| Ethanol | 18 mg/mL (45.3 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.17 mL | 125.83 mL | 251.65 mL |
| 0.5 mM | 5.03 mL | 25.17 mL | 50.33 mL |
| 1 mM | 2.52 mL | 12.58 mL | 25.17 mL |
| 5 mM | 0.5 mL | 2.52 mL | 5.03 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
