Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Digoxin is a sodium-potassium pump inhibitor. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14242 |
|---|---|
| Formula | C41H64O14 |
| Molecular Weight | 780.94 |
| CAS Number | 20830-75-5 |
| SMILES | C[C@@H]1[C@H]([C@H](C[C@@H](O1)O[C@@H]2[C@H](O[C@H](C[C@@H]2O)O[C@@H]3[C@H](O[C@H](C[C@@H]3O)O[C@H]4CC[C@]5([C@@H](C4)CC[C@@H]6[C@@H]5C[C@H]([C@]7([C@@]6(CC[C@@H]7C8=CC(=O)OC8)O)C)O)C)C)C)O)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 96 mg/mL (122.93 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 2% DMSO+corn oil | 1 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 12.81 mL | 64.03 mL | 128.05 mL |
| 0.5 mM | 2.56 mL | 12.81 mL | 25.61 mL |
| 1 mM | 1.28 mL | 6.4 mL | 12.81 mL |
| 5 mM | 0.26 mL | 1.28 mL | 2.56 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
