Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | DMX-5804 is a potent, orally active and selective MAP4K4 inhibitor, with an IC50 of 3 nM, a pIC50 of 8.55 for human MAP4K4, less potent on MINK1/MAP4K6 (pIC50, 8.18), and TNIK/MAP4K7 (pIC50, 7.96). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A20199 |
|---|---|
| Formula | C21H19N3O3 |
| Molecular Weight | 361.39 |
| CAS Number | 2306178-56-1 |
| SMILES | O=C1NC=NC2=C1C(C3=CC=C(OCCOC)C=C3)=CN2C4=CC=CC=C4 |
| Synonyms | DMX5804, DMX 5804 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 71 mg/mL (196.46 mM) | |
| Water | Insoluble | ||
| Ethanol | 1 mg/mL (2.77 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.67 mL | 138.35 mL | 276.71 mL |
| 0.5 mM | 5.53 mL | 27.67 mL | 55.34 mL |
| 1 mM | 2.77 mL | 13.84 mL | 27.67 mL |
| 5 mM | 0.55 mL | 2.77 mL | 5.53 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
