Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | Donepezil is a centrally acting reversible acetylcholinesterase inhibitor. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10330 |
|---|---|
| Formula | C24H29NO3.HCl |
| Molecular Weight | 416 |
| CAS Number | 120011-70-3 |
| SMILES | COC1=C(C=C2C(=C1)CC(C2=O)CC3CCN(CC3)CC4=CC=CC=C4)OC.Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Insoluble | |
| Water | 5 mg/mL (12.01 mM) | ||
| Ethanol | Insoluble | ||
| In vivo | 30% propylene glycol, 5% Tween 80, 65% D5W | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.04 mL | 120.19 mL | 240.38 mL |
| 0.5 mM | 4.81 mL | 24.04 mL | 48.08 mL |
| 1 mM | 2.4 mL | 12.02 mL | 24.04 mL |
| 5 mM | 0.48 mL | 2.4 mL | 4.81 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
