Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Drofenine hydrochloride is a potent competitive inhibitor of BChE, and the ki values of Drofenine is calculated to be 3 uM. |
|---|
| Catalog Num | A17724 |
|---|---|
| Formula | C20H32ClNO2 |
| Molecular Weight | 353.93 |
| CAS Number | 548-66-3 |
| SMILES | O=C(OCCN(CC)CC)C(C1CCCCC1)C2=CC=CC=C2.[H]Cl |
| Synonyms | Cycloadiphenine hydrochloride,NSC 42559, Profenene hydrochloride, Trasentin H, Trasentine A, Trasentine-A |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 65 mg/mL (183.65 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.25 mL | 141.27 mL | 282.54 mL |
| 0.5 mM | 5.65 mL | 28.25 mL | 56.51 mL |
| 1 mM | 2.83 mL | 14.13 mL | 28.25 mL |
| 5 mM | 0.57 mL | 2.83 mL | 5.65 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
