Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Droxidopa(L-DOPS), the mixture of Droxidopa (w/w80%) and Pharmaceutical starch (w/w20%), acts as a prodrug to the neurotransmitters norepinephrine (noradrenaline) and epinephrine (adrenaline). |
|---|
| Catalog Num | A21541 |
|---|---|
| Formula | C9H11NO5 |
| Molecular Weight | 213.19 |
| CAS Number | 23651-95-8 |
| SMILES | OC1=C(O)C=CC([C@@H](O)[C@@H](C(O)=O)N)=C1 |
| Synonyms | L-DOPS; DOPS; SM5688, SM 5688, SM-5688 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Insoluble | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 46.91 mL | 234.53 mL | 469.07 mL |
| 0.5 mM | 9.38 mL | 46.91 mL | 93.81 mL |
| 1 mM | 4.69 mL | 23.45 mL | 46.91 mL |
| 5 mM | 0.94 mL | 4.69 mL | 9.38 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
