Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Elenbecestat (E2609) is a potent, orally bioavailable and CNS-penetrant BACE-1 inhibitor for the treatment of Alzheimer's disease (AD). |
|---|
| Catalog Num | A19223 |
|---|---|
| Formula | C19H18F3N5O2S |
| Molecular Weight | 437.44 |
| CAS Number | 1388651-30-6 |
| SMILES | FC1=CC=C(NC(C2=NC=C(C(F)F)N=C2)=O)C=C1[C@@]3(N=C(N)SC4)[C@@]4([H])[C@@H](C)OC3 |
| Synonyms | E2609, E 2609, E-2609 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 78 mg/mL (178.31 mM) | |
| Water | Insoluble | ||
| Ethanol | 10 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.86 mL | 114.3 mL | 228.6 mL |
| 0.5 mM | 4.57 mL | 22.86 mL | 45.72 mL |
| 1 mM | 2.29 mL | 11.43 mL | 22.86 mL |
| 5 mM | 0.46 mL | 2.29 mL | 4.57 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
