Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Emodepside (PF 1022-221) is a cyclooctadepsipeptide with broad-spectrum anthelmintic activity. |
|---|
| Catalog Num | A20377 |
|---|---|
| Formula | C60H90N6O14 |
| Molecular Weight | 1119.39 |
| CAS Number | 155030-63-0 |
| SMILES | O=C(N([C@H](C(O[C@](C(N([C@H](C(O[C@H](CC1=CC=C(N2CCOCC2)C=C1)C(N(C)[C@H](CC(C)C)C(O[C@H](C)C(N(C)[C@@H](CC(C)C)C3=O)=O)=O)=O)=O)CC(C)C)C)=O)([H])C)=O)CC(C)C)C)[C@H](O3)CC4=CC=C(N5CCOCC5)C=C4 |
| Synonyms | Bay 44-4400 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 92 mg/mL (82.18 mM) | |
| Water | Insoluble | ||
| Ethanol | 18 mg/mL (16.07 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 8.93 mL | 44.67 mL | 89.33 mL |
| 0.5 mM | 1.79 mL | 8.93 mL | 17.87 mL |
| 1 mM | 0.89 mL | 4.47 mL | 8.93 mL |
| 5 mM | 0.18 mL | 0.89 mL | 1.79 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
