Loading distributor info...
| Description | Enalaprilat is the active metabolite of enalapril. It is the first dicarboxylate-containing ACE inhibitor and was developed partly to overcome these limitations of captopril. |
|---|
| Catalog Num | A10351 |
|---|---|
| Formula | C18H24N2O5.2H2O |
| Molecular Weight | 384.42 |
| CAS Number | 84680-54-6 |
| SMILES | C[C@@H](C(=O)N1CCC[C@H]1C(=O)O)N[C@@H](CCC2=CC=CC=C2)C(=O)O.O.O |
| Synonyms | Vasotec |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 67 mg/mL (192.3 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.01 mL | 130.07 mL | 260.13 mL |
| 0.5 mM | 5.2 mL | 26.01 mL | 52.03 mL |
| 1 mM | 2.6 mL | 13.01 mL | 26.01 mL |
| 5 mM | 0.52 mL | 2.6 mL | 5.2 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
