Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | F1063-0967 is a novel inhibitor of dual-specificity phosphatase 26 (DUSP26), inducing apoptosis in IMR-32 cell line. |
|---|
| Catalog Num | A17090 |
|---|---|
| Formula | C24H24N2O5S2 |
| Molecular Weight | 484.58 |
| CAS Number | 613225-56-2 |
| SMILES | O=C(O)C1=CC=C(NC(CCCCCN(C/2=O)C(SC2=C/C3=CC=C(C)C=C3)=S)=O)C=C1O |
| Synonyms | F10630967 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 93 mg/mL (191.91 mM) | |
| Water | <1 mg/mL | ||
| Ethanol | <1 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.64 mL | 103.18 mL | 206.36 mL |
| 0.5 mM | 4.13 mL | 20.64 mL | 41.27 mL |
| 1 mM | 2.06 mL | 10.32 mL | 20.64 mL |
| 5 mM | 0.41 mL | 2.06 mL | 4.13 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
