Loading distributor info...
| Description | Fatostatin Hydrobromide is an inhibitor of sterol regulatory element-binding protein (SREBP). |
|---|
| Catalog Num | A16121 |
|---|---|
| Formula | C18H18N2S.HBr |
| Molecular Weight | 375.33 |
| CAS Number | 298197-04-3 |
| SMILES | CC(C=C1)=CC=C1C2=CSC(C3=CC(CCC)=NC=C3)=N2.Br |
| Synonyms | Fatostatin A |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 6 mg/mL (15.99 mM) | |
| Water | Insoluble | ||
| Ethanol | 23 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.64 mL | 133.22 mL | 266.43 mL |
| 0.5 mM | 5.33 mL | 26.64 mL | 53.29 mL |
| 1 mM | 2.66 mL | 13.32 mL | 26.64 mL |
| 5 mM | 0.53 mL | 2.66 mL | 5.33 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
