Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | FB23-2 is a potent FTO inhibitor with an IC50 of 2.6 μM. |
|---|
| Catalog Num | A18918 |
|---|---|
| Formula | C18H15Cl2N3O3 |
| Molecular Weight | 392.23 |
| CAS Number | 2243736-45-8 |
| SMILES | O=C(NO)C1=CC=CC=C1NC2=C(Cl)C=C(C3=C(C)ON=C3C)C=C2Cl |
| Synonyms | FB23-2; FB-23-2; FB 23-2; FB232; FB-232; FB 232; |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 75 mg/mL (191.2 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.5 mL | 127.48 mL | 254.95 mL |
| 0.5 mM | 5.1 mL | 25.5 mL | 50.99 mL |
| 1 mM | 2.55 mL | 12.75 mL | 25.5 mL |
| 5 mM | 0.51 mL | 2.55 mL | 5.1 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
