Loading distributor info...
| Description | Fendiline hydrochloride is a nonselective calcium channel blocker. |
|---|
| Catalog Num | A17575 |
|---|---|
| Formula | C23H26ClN |
| Molecular Weight | 351.91 |
| CAS Number | 13636-18-5 |
| SMILES | CC(NCCC(C1=CC=CC=C1)C2=CC=CC=C2)C3=CC=CC=C3.[H]Cl |
| Synonyms | Fendiline Hydrochloride; Fendiline HCl; |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 68 mg/mL (193.23 mM) | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.42 mL | 142.08 mL | 284.16 mL |
| 0.5 mM | 5.68 mL | 28.42 mL | 56.83 mL |
| 1 mM | 2.84 mL | 14.21 mL | 28.42 mL |
| 5 mM | 0.57 mL | 2.84 mL | 5.68 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
