Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Fipronil is a broad-spectrum insecticide that belongs to the phenylpyrazole chemical family. Fipronil disrupts the insect central nervous system by blocking GABA-gated chloride channels and glutamate-gated chloride (GluCl) channels. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17609 |
|---|---|
| Formula | C12H4Cl2F6N4OS |
| Molecular Weight | 437.14 |
| CAS Number | 120068-37-3 |
| SMILES | N#CC1=NN(C2=C(Cl)C=C(C(F)(F)F)C=C2Cl)C(N)=C1S(C(F)(F)F)=O |
| Synonyms | Fipronil; HSDB 7051; MB 46030; M&B 46030; |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 77 mg/mL (176.14 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.88 mL | 114.38 mL | 228.76 mL |
| 0.5 mM | 4.58 mL | 22.88 mL | 45.75 mL |
| 1 mM | 2.29 mL | 11.44 mL | 22.88 mL |
| 5 mM | 0.46 mL | 2.29 mL | 4.58 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
