Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Flavopiridol (Alvocidib) is a cyclin-dependent kinase inhibitor under clinical development for the treatment of chronic lymphocytic leukemia. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10390 |
|---|---|
| Formula | C21H20ClNO5 |
| Molecular Weight | 401.8 |
| CAS Number | 146426-40-6 |
| SMILES | CN1CC[C@@H]([C@@H](C1)O)C2=C(C=C(C3=C2OC(=CC3=O)C4=CC=CC=C4Cl)O)O |
| Synonyms | HMR-1275, L868275 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 14 mg/mL (34.83 mM) | |
| Water | Insoluble | ||
| Ethanol | 7 mg/mL (17.41 mM) | ||
| In vivo | 5% DMSO+30% PEG 300+ddH2O | 2.3 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.89 mL | 124.44 mL | 248.88 mL |
| 0.5 mM | 4.98 mL | 24.89 mL | 49.78 mL |
| 1 mM | 2.49 mL | 12.44 mL | 24.89 mL |
| 5 mM | 0.5 mL | 2.49 mL | 4.98 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
