Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Fluralaner (INN) is a systemic insecticide and acaricide Fluralaner through potent blockage of GABA and L-glutamate gated chloride channels. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A18068 |
|---|---|
| Formula | C22H17Cl2F6N3O3 |
| Molecular Weight | 556.29 |
| CAS Number | 864731-61-3 |
| SMILES | O=C(NCC(NCC(F)(F)F)=O)C1=CC=C(C2=NOC(C(F)(F)F)(C3=CC(Cl)=CC(Cl)=C3)C2)C=C1C |
| Synonyms | AH252723; AH-252723; AH 252723; A-1443; A1443; A 1443; Fluralaner, trade name: Bravecto. |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 99 mg/mL (177.96 mM) | |
| Water | Insoluble | ||
| Ethanol | 25 mg/mL (44.94 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.98 mL | 89.88 mL | 179.76 mL |
| 0.5 mM | 3.6 mL | 17.98 mL | 35.95 mL |
| 1 mM | 1.8 mL | 8.99 mL | 17.98 mL |
| 5 mM | 0.36 mL | 1.8 mL | 3.6 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
