Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Fusidate Sodium is a sodium salt form of fusidic acid, a bacteriostatic antibiotic derived from the fungus Fusidium coccineum and used as a topical medication to treat skin infections. |
|---|
| Catalog Num | A12576 |
|---|---|
| Formula | C31H47NaO6 |
| Molecular Weight | 538.7 |
| CAS Number | 751-94-0 |
| SMILES | CC1C2CCC3(C(C2(CCC1O)C)C(CC4C3(CC(C4=C(CCC=C(C)C)C(=O)[O-])OC(=O)C)C)O)C.[Na+] |
| Synonyms | Fusidic acid sodium salt |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 89 mg/mL (165.21 mM) | |
| Water | 89 mg/mL (165.21 mM) | ||
| Ethanol | 89 mg/mL (165.21 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.56 mL | 92.82 mL | 185.63 mL |
| 0.5 mM | 3.71 mL | 18.56 mL | 37.13 mL |
| 1 mM | 1.86 mL | 9.28 mL | 18.56 mL |
| 5 mM | 0.37 mL | 1.86 mL | 3.71 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
